C22H38N4O9 — CID 177268550
(2R)-2-[4,10-bis(carboxymethyl)-7-(2,2-dihydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]-6-methyl-5-oxohept-6-enoic acid (PubChem CID 177268550) has the molecular formula C22H38N4O9 and a molecular weight of 502.57 g/mol. Its IUPAC name is (2R)-2-[4,10-bis(carboxymethyl)-7-(2,2-dihydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]-6-methyl-5-oxohept-6-enoic acid.
| Compound Name | (2R)-2-[4,10-bis(carboxymethyl)-7-(2,2-dihydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]-6-methyl-5-oxohept-6-enoic acid |
|---|---|
| PubChem CID | 177268550 |
| Molecular Formula | C22H38N4O9 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | (2R)-2-[4,10-bis(carboxymethyl)-7-(2,2-dihydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]-6-methyl-5-oxohept-6-enoic acid |
| SMILES | C=C(C)C(=O)CC[C@H](C(=O)O)N1CCN(CC(=O)O)CCN(CC(O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C22H38N4O9/c1-16(2)18(27)4-3-17(22(34)35)26-11-9-24(14-20(30)31)7-5-23(13-19(28)29)6-8-25(10-12-26)15-21(32)33/h17,19,28-29H,1,3-15H2,2H3,(H,30,31)(H,32,33)(H,34,35)/t17-/m1/s1 |
| InChIKey | ZEAUKHPHMXHUIS-QGZVFWFLSA-N |
| XLogP | -1.93 |
| TPSA | 182.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|