C21H33N3O12 — CID 102518327
2-[4,7-bis(1,3-dicarboxypropyl)-1,4,7-triazonan-1-yl]pentanedioic acid (PubChem CID 102518327) has the molecular formula C21H33N3O12 and a molecular weight of 519.50 g/mol. Its IUPAC name is 2-[4,7-bis(1,3-dicarboxypropyl)-1,4,7-triazonan-1-yl]pentanedioic acid.
| Compound Name | 2-[4,7-bis(1,3-dicarboxypropyl)-1,4,7-triazonan-1-yl]pentanedioic acid |
|---|---|
| PubChem CID | 102518327 |
| Molecular Formula | C21H33N3O12 |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | 2-[4,7-bis(1,3-dicarboxypropyl)-1,4,7-triazonan-1-yl]pentanedioic acid |
| SMILES | O=C(O)CCC(C(=O)O)N1CCN(C(CCC(=O)O)C(=O)O)CCN(C(CCC(=O)O)C(=O)O)CC1 |
| InChI | InChI=1S/C21H33N3O12/c25-16(26)4-1-13(19(31)32)22-7-9-23(14(20(33)34)2-5-17(27)28)11-12-24(10-8-22)15(21(35)36)3-6-18(29)30/h13-15H,1-12H2,(H,25,26)(H,27,28)(H,29,30)(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | DTUGZHMBFKHVOU-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 233.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |