C18H24N6O10 — CID 4894669
2-[9-(1,3-dicarboxypropyl)-6,14-dioxo-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecan-3-yl]pentanedioic acid (PubChem CID 4894669) has the molecular formula C18H24N6O10 and a molecular weight of 484.42 g/mol. Its IUPAC name is 2-[9-(1,3-dicarboxypropyl)-6,14-dioxo-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecan-3-yl]pentanedioic acid.
| Compound Name | 2-[9-(1,3-dicarboxypropyl)-6,14-dioxo-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecan-3-yl]pentanedioic acid |
|---|---|
| PubChem CID | 4894669 |
| Molecular Formula | C18H24N6O10 |
| Molecular Weight | 484.42 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 2-[9-(1,3-dicarboxypropyl)-6,14-dioxo-1,3,5,7,9,11-hexazatetracyclo[9.2.1.05,13.07,12]tetradecan-3-yl]pentanedioic acid |
| SMILES | O=C(O)CCC(C(=O)O)N1CN2C(=O)N3CN(C(CCC(=O)O)C(=O)O)CN4C(=O)N(C1)C2C34 |
| InChI | InChI=1S/C18H24N6O10/c25-11(26)3-1-9(15(29)30)19-5-21-13-14-23(17(21)33)7-20(8-24(14)18(34)22(13)6-19)10(16(31)32)2-4-12(27)28/h9-10,13-14H,1-8H2,(H,25,26)(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | YWDFGMVRFNSFLF-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 202.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.42 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |