piperazine;2-piperazin-1-ylhexanedioic acid

C14H28N4O4 — CID 157149096

IUPACpiperazine;2-piperazin-1-ylhexanedioic acid
SMILESC1CNCCN1.O=C(O)CCCC(C(=O)O)N1CCNCC1
InChIInChI=1S/C10H18N2O4.C4H10N2/c13-9(14)3-1-2-8(10(15)16)12-6-4-11-5-7-12;1-2-6-4-3-5-1/h8,11H,1-7H2,(H,13,14)(H,15,16);5-6H,1-4H2
InChIKeyALAUXXXBKKBAPB-UHFFFAOYSA-N
MW316.40 g/mol
LogP-1.22
Rot. Bonds6

About piperazine;2-piperazin-1-ylhexanedioic acid

piperazine;2-piperazin-1-ylhexanedioic acid (PubChem CID 157149096) has the molecular formula C14H28N4O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is piperazine;2-piperazin-1-ylhexanedioic acid.

Molecular Properties

Compound Namepiperazine;2-piperazin-1-ylhexanedioic acid
PubChem CID157149096
Molecular FormulaC14H28N4O4
Molecular Weight316.40 g/mol
Exact Mass316.21
IUPAC Namepiperazine;2-piperazin-1-ylhexanedioic acid
SMILESC1CNCCN1.O=C(O)CCCC(C(=O)O)N1CCNCC1
InChIInChI=1S/C10H18N2O4.C4H10N2/c13-9(14)3-1-2-8(10(15)16)12-6-4-11-5-7-12;1-2-6-4-3-5-1/h8,11H,1-7H2,(H,13,14)(H,15,16);5-6H,1-4H2
InChIKeyALAUXXXBKKBAPB-UHFFFAOYSA-N
XLogP-1.22
TPSA113.93 Ų
H-Bond Donors5
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500316.40
LogP ≤ 5-1.22
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 106

Analyze piperazine;2-piperazin-1-ylhexanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of piperazine;2-piperazin-1-ylhexanedioic acid?
The IUPAC name of piperazine;2-piperazin-1-ylhexanedioic acid (CID 157149096) is piperazine;2-piperazin-1-ylhexanedioic acid.
What is the SMILES notation for piperazine;2-piperazin-1-ylhexanedioic acid?
The canonical SMILES for piperazine;2-piperazin-1-ylhexanedioic acid is C1CNCCN1.O=C(O)CCCC(C(=O)O)N1CCNCC1.
What is the InChIKey of piperazine;2-piperazin-1-ylhexanedioic acid?
The InChIKey is ALAUXXXBKKBAPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O4.C4H10N2/c13-9(14)3-1-2-8(10(15)16)12-6-4-11-5-7-12;1-2-6-4-3-5-1/h8,11H,1-7H2,(H,13,14)(H,15,16);5-6H,1-4H2.
What are the key properties of piperazine;2-piperazin-1-ylhexanedioic acid?
piperazine;2-piperazin-1-ylhexanedioic acid has a molecular weight of 316.40 g/mol, XLogP of -1.22, 6 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine;2-piperazin-1-ylhexanedioic acid is sourced from PubChem (CID 157149096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).