C14H28N4O4 — CID 157149096
piperazine;2-piperazin-1-ylhexanedioic acid (PubChem CID 157149096) has the molecular formula C14H28N4O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is piperazine;2-piperazin-1-ylhexanedioic acid.
| Compound Name | piperazine;2-piperazin-1-ylhexanedioic acid |
|---|---|
| PubChem CID | 157149096 |
| Molecular Formula | C14H28N4O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | piperazine;2-piperazin-1-ylhexanedioic acid |
| SMILES | C1CNCCN1.O=C(O)CCCC(C(=O)O)N1CCNCC1 |
| InChI | InChI=1S/C10H18N2O4.C4H10N2/c13-9(14)3-1-2-8(10(15)16)12-6-4-11-5-7-12;1-2-6-4-3-5-1/h8,11H,1-7H2,(H,13,14)(H,15,16);5-6H,1-4H2 |
| InChIKey | ALAUXXXBKKBAPB-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |