C14H28N4O2 — CID 174209258
2-(1,4,7,10-tetrazacyclododec-1-yl)hex-5-enoic acid (PubChem CID 174209258) has the molecular formula C14H28N4O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-(1,4,7,10-tetrazacyclododec-1-yl)hex-5-enoic acid.
| Compound Name | 2-(1,4,7,10-tetrazacyclododec-1-yl)hex-5-enoic acid |
|---|---|
| PubChem CID | 174209258 |
| Molecular Formula | C14H28N4O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | 2-(1,4,7,10-tetrazacyclododec-1-yl)hex-5-enoic acid |
| SMILES | C=CCCC(C(=O)O)N1CCNCCNCCNCC1 |
| InChI | InChI=1S/C14H28N4O2/c1-2-3-4-13(14(19)20)18-11-9-16-7-5-15-6-8-17-10-12-18/h2,13,15-17H,1,3-12H2,(H,19,20) |
| InChIKey | GEGBYJKEHRGDSR-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|