C18H30N4O2 — CID 141113240
4-phenyl-2-(1,4,7,10-tetrazacyclododec-1-yl)butanoic acid (PubChem CID 141113240) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is 4-phenyl-2-(1,4,7,10-tetrazacyclododec-1-yl)butanoic acid.
| Compound Name | 4-phenyl-2-(1,4,7,10-tetrazacyclododec-1-yl)butanoic acid |
|---|---|
| PubChem CID | 141113240 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | 4-phenyl-2-(1,4,7,10-tetrazacyclododec-1-yl)butanoic acid |
| SMILES | O=C(O)C(CCc1ccccc1)N1CCNCCNCCNCC1 |
| InChI | InChI=1S/C18H30N4O2/c23-18(24)17(7-6-16-4-2-1-3-5-16)22-14-12-20-10-8-19-9-11-21-13-15-22/h1-5,17,19-21H,6-15H2,(H,23,24) |
| InChIKey | JGQIDDOKMGTCFS-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |