C8H16Cl2N2O4 — CID 68966423
2-piperazin-1-ylbutanedioic acid;dihydrochloride (PubChem CID 68966423) has the molecular formula C8H16Cl2N2O4 and a molecular weight of 275.13 g/mol. Its IUPAC name is 2-piperazin-1-ylbutanedioic acid;dihydrochloride.
| Compound Name | 2-piperazin-1-ylbutanedioic acid;dihydrochloride |
|---|---|
| PubChem CID | 68966423 |
| Molecular Formula | C8H16Cl2N2O4 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 2-piperazin-1-ylbutanedioic acid;dihydrochloride |
| SMILES | Cl.Cl.O=C(O)CC(C(=O)O)N1CCNCC1 |
| InChI | InChI=1S/C8H14N2O4.2ClH/c11-7(12)5-6(8(13)14)10-3-1-9-2-4-10;;/h6,9H,1-5H2,(H,11,12)(H,13,14);2*1H |
| InChIKey | ZPEOYMZARYRRBQ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |