C17H30N4O8 — CID 23209455
4-(1,4-dicarboxybutyl)-3-methyl-1,4,7,10-tetrazacyclododecane-1,7-dicarboxylic acid (PubChem CID 23209455) has the molecular formula C17H30N4O8 and a molecular weight of 418.45 g/mol. Its IUPAC name is 4-(1,4-dicarboxybutyl)-3-methyl-1,4,7,10-tetrazacyclododecane-1,7-dicarboxylic acid.
| Compound Name | 4-(1,4-dicarboxybutyl)-3-methyl-1,4,7,10-tetrazacyclododecane-1,7-dicarboxylic acid |
|---|---|
| PubChem CID | 23209455 |
| Molecular Formula | C17H30N4O8 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 4-(1,4-dicarboxybutyl)-3-methyl-1,4,7,10-tetrazacyclododecane-1,7-dicarboxylic acid |
| SMILES | CC1CN(C(=O)O)CCNCCN(C(=O)O)CCN1C(CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H30N4O8/c1-12-11-20(17(28)29)8-6-18-5-7-19(16(26)27)9-10-21(12)13(15(24)25)3-2-4-14(22)23/h12-13,18H,2-11H2,1H3,(H,22,23)(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | HRIOTSWRZPJOLA-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 170.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |