2-(2,3-diamino-2-ethylpiperazin-1-yl)hexanedioic acid

C12H24N4O4 — CID 70388141

IUPAC2-(2,3-diamino-2-ethylpiperazin-1-yl)hexanedioic acid
SMILESCCC1(N)C(N)NCCN1C(CCCC(=O)O)C(=O)O
InChIInChI=1S/C12H24N4O4/c1-2-12(14)11(13)15-6-7-16(12)8(10(19)20)4-3-5-9(17)18/h8,11,15H,2-7,13-14H2,1H3,(H,17,18)(H,19,20)
InChIKeyRROAJIASUAOKSW-UHFFFAOYSA-N
MW288.35 g/mol
LogP-1.05
Rot. Bonds7

About 2-(2,3-diamino-2-ethylpiperazin-1-yl)hexanedioic acid

2-(2,3-diamino-2-ethylpiperazin-1-yl)hexanedioic acid (PubChem CID 70388141) has the molecular formula C12H24N4O4 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-(2,3-diamino-2-ethylpiperazin-1-yl)hexanedioic acid.

Molecular Properties

Compound Name2-(2,3-diamino-2-ethylpiperazin-1-yl)hexanedioic acid
PubChem CID70388141
Molecular FormulaC12H24N4O4
Molecular Weight288.35 g/mol
Exact Mass288.18
IUPAC Name2-(2,3-diamino-2-ethylpiperazin-1-yl)hexanedioic acid
SMILESCCC1(N)C(N)NCCN1C(CCCC(=O)O)C(=O)O
InChIInChI=1S/C12H24N4O4/c1-2-12(14)11(13)15-6-7-16(12)8(10(19)20)4-3-5-9(17)18/h8,11,15H,2-7,13-14H2,1H3,(H,17,18)(H,19,20)
InChIKeyRROAJIASUAOKSW-UHFFFAOYSA-N
XLogP-1.05
TPSA141.91 Ų
H-Bond Donors5
H-Bond Acceptors6
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.35
LogP ≤ 5-1.05
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 106

Analyze 2-(2,3-diamino-2-ethylpiperazin-1-yl)hexanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3-diamino-2-ethylpiperazin-1-yl)hexanedioic acid?
The IUPAC name of 2-(2,3-diamino-2-ethylpiperazin-1-yl)hexanedioic acid (CID 70388141) is 2-(2,3-diamino-2-ethylpiperazin-1-yl)hexanedioic acid.
What is the SMILES notation for 2-(2,3-diamino-2-ethylpiperazin-1-yl)hexanedioic acid?
The canonical SMILES for 2-(2,3-diamino-2-ethylpiperazin-1-yl)hexanedioic acid is CCC1(N)C(N)NCCN1C(CCCC(=O)O)C(=O)O.
What is the InChIKey of 2-(2,3-diamino-2-ethylpiperazin-1-yl)hexanedioic acid?
The InChIKey is RROAJIASUAOKSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N4O4/c1-2-12(14)11(13)15-6-7-16(12)8(10(19)20)4-3-5-9(17)18/h8,11,15H,2-7,13-14H2,1H3,(H,17,18)(H,19,20).
What are the key properties of 2-(2,3-diamino-2-ethylpiperazin-1-yl)hexanedioic acid?
2-(2,3-diamino-2-ethylpiperazin-1-yl)hexanedioic acid has a molecular weight of 288.35 g/mol, XLogP of -1.05, 7 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-diamino-2-ethylpiperazin-1-yl)hexanedioic acid is sourced from PubChem (CID 70388141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).