C12H24N4O4 — CID 70388141
2-(2,3-diamino-2-ethylpiperazin-1-yl)hexanedioic acid (PubChem CID 70388141) has the molecular formula C12H24N4O4 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-(2,3-diamino-2-ethylpiperazin-1-yl)hexanedioic acid.
| Compound Name | 2-(2,3-diamino-2-ethylpiperazin-1-yl)hexanedioic acid |
|---|---|
| PubChem CID | 70388141 |
| Molecular Formula | C12H24N4O4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 2-(2,3-diamino-2-ethylpiperazin-1-yl)hexanedioic acid |
| SMILES | CCC1(N)C(N)NCCN1C(CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H24N4O4/c1-2-12(14)11(13)15-6-7-16(12)8(10(19)20)4-3-5-9(17)18/h8,11,15H,2-7,13-14H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | RROAJIASUAOKSW-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |