C17H37N3O2 — CID 162263600
N,N-dimethyldecan-1-amine;piperazine-1-carboxylic acid (PubChem CID 162263600) has the molecular formula C17H37N3O2 and a molecular weight of 315.50 g/mol. Its IUPAC name is N,N-dimethyldecan-1-amine;piperazine-1-carboxylic acid.
| Compound Name | N,N-dimethyldecan-1-amine;piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 162263600 |
| Molecular Formula | C17H37N3O2 |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | N,N-dimethyldecan-1-amine;piperazine-1-carboxylic acid |
| SMILES | CCCCCCCCCCN(C)C.O=C(O)N1CCNCC1 |
| InChI | InChI=1S/C12H27N.C5H10N2O2/c1-4-5-6-7-8-9-10-11-12-13(2)3;8-5(9)7-3-1-6-2-4-7/h4-12H2,1-3H3;6H,1-4H2,(H,8,9) |
| InChIKey | ZZPBQRONSFBWMT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|