C35H72N4O3 — CID 168924589
formic acid;2-[nonyl-[2-[nonyl(octyl)amino]ethyl]amino]-1-piperazin-1-ylethanone (PubChem CID 168924589) has the molecular formula C35H72N4O3 and a molecular weight of 596.99 g/mol. Its IUPAC name is formic acid;2-[nonyl-[2-[nonyl(octyl)amino]ethyl]amino]-1-piperazin-1-ylethanone.
| Compound Name | formic acid;2-[nonyl-[2-[nonyl(octyl)amino]ethyl]amino]-1-piperazin-1-ylethanone |
|---|---|
| PubChem CID | 168924589 |
| Molecular Formula | C35H72N4O3 |
| Molecular Weight | 596.99 g/mol |
| Exact Mass | 596.56 |
| IUPAC Name | formic acid;2-[nonyl-[2-[nonyl(octyl)amino]ethyl]amino]-1-piperazin-1-ylethanone |
| SMILES | CCCCCCCCCN(CCCCCCCC)CCN(CCCCCCCCC)CC(=O)N1CCNCC1.O=CO |
| InChI | InChI=1S/C34H70N4O.CH2O2/c1-4-7-10-13-16-19-22-27-36(26-21-18-15-12-9-6-3)31-32-37(28-23-20-17-14-11-8-5-2)33-34(39)38-29-24-35-25-30-38;2-1-3/h35H,4-33H2,1-3H3;1H,(H,2,3) |
| InChIKey | IXOPVRLZVIEJTH-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.99 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|