C56H111N5O4 — CID 146540801
methyl 8-[2-[decyl(nonyl)amino]ethyl-[2-[4-[2-[di(nonyl)amino]acetyl]piperazin-1-yl]-2-oxoethyl]amino]octanoate (PubChem CID 146540801) has the molecular formula C56H111N5O4 and a molecular weight of 918.53 g/mol. Its IUPAC name is methyl 8-[2-[decyl(nonyl)amino]ethyl-[2-[4-[2-[di(nonyl)amino]acetyl]piperazin-1-yl]-2-oxoethyl]amino]octanoate.
| Compound Name | methyl 8-[2-[decyl(nonyl)amino]ethyl-[2-[4-[2-[di(nonyl)amino]acetyl]piperazin-1-yl]-2-oxoethyl]amino]octanoate |
|---|---|
| PubChem CID | 146540801 |
| Molecular Formula | C56H111N5O4 |
| Molecular Weight | 918.53 g/mol |
| Exact Mass | 917.86 |
| IUPAC Name | methyl 8-[2-[decyl(nonyl)amino]ethyl-[2-[4-[2-[di(nonyl)amino]acetyl]piperazin-1-yl]-2-oxoethyl]amino]octanoate |
| SMILES | CCCCCCCCCCN(CCCCCCCCC)CCN(CCCCCCCC(=O)OC)CC(=O)N1CCN(C(=O)CN(CCCCCCCCC)CCCCCCCCC)CC1 |
| InChI | InChI=1S/C56H111N5O4/c1-6-10-14-18-22-26-30-36-42-57(41-35-29-23-19-15-11-7-2)46-47-59(45-39-33-27-28-34-40-56(64)65-5)53-55(63)61-50-48-60(49-51-61)54(62)52-58(43-37-31-24-20-16-12-8-3)44-38-32-25-21-17-13-9-4/h6-53H2,1-5H3 |
| InChIKey | ZYLNZGVKMHUPHO-UHFFFAOYSA-N |
| XLogP | 13.47 |
| TPSA | 76.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.53 |
| LogP ≤ 5 | 13.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|