C54H109N5O2 — CID 176622154
1-[4-[2-[2-[di(nonyl)amino]ethyl-nonylamino]acetyl]piperazin-1-yl]-2-(nonylamino)decan-1-one (PubChem CID 176622154) has the molecular formula C54H109N5O2 and a molecular weight of 860.50 g/mol. Its IUPAC name is 1-[4-[2-[2-[di(nonyl)amino]ethyl-nonylamino]acetyl]piperazin-1-yl]-2-(nonylamino)decan-1-one.
| Compound Name | 1-[4-[2-[2-[di(nonyl)amino]ethyl-nonylamino]acetyl]piperazin-1-yl]-2-(nonylamino)decan-1-one |
|---|---|
| PubChem CID | 176622154 |
| Molecular Formula | C54H109N5O2 |
| Molecular Weight | 860.50 g/mol |
| Exact Mass | 859.86 |
| IUPAC Name | 1-[4-[2-[2-[di(nonyl)amino]ethyl-nonylamino]acetyl]piperazin-1-yl]-2-(nonylamino)decan-1-one |
| SMILES | CCCCCCCCCNC(CCCCCCCC)C(=O)N1CCN(C(=O)CN(CCCCCCCCC)CCN(CCCCCCCCC)CCCCCCCCC)CC1 |
| InChI | InChI=1S/C54H109N5O2/c1-6-11-16-21-26-31-36-41-55-52(40-35-30-25-20-15-10-5)54(61)59-49-47-58(48-50-59)53(60)51-57(44-39-34-29-24-19-14-9-4)46-45-56(42-37-32-27-22-17-12-7-2)43-38-33-28-23-18-13-8-3/h52,55H,6-51H2,1-5H3 |
| InChIKey | OEAGBTPPMLTTRB-UHFFFAOYSA-N |
| XLogP | 13.97 |
| TPSA | 59.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.50 |
| LogP ≤ 5 | 13.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|