C55H110N4O3 — CID 176836457
[1-[2-[2-[di(nonyl)amino]ethyl-nonylamino]acetyl]pyrrolidin-3-yl] 2-[di(nonyl)amino]acetate (PubChem CID 176836457) has the molecular formula C55H110N4O3 and a molecular weight of 875.51 g/mol. Its IUPAC name is [1-[2-[2-[di(nonyl)amino]ethyl-nonylamino]acetyl]pyrrolidin-3-yl] 2-[di(nonyl)amino]acetate.
| Compound Name | [1-[2-[2-[di(nonyl)amino]ethyl-nonylamino]acetyl]pyrrolidin-3-yl] 2-[di(nonyl)amino]acetate |
|---|---|
| PubChem CID | 176836457 |
| Molecular Formula | C55H110N4O3 |
| Molecular Weight | 875.51 g/mol |
| Exact Mass | 874.86 |
| IUPAC Name | [1-[2-[2-[di(nonyl)amino]ethyl-nonylamino]acetyl]pyrrolidin-3-yl] 2-[di(nonyl)amino]acetate |
| SMILES | CCCCCCCCCN(CCCCCCCCC)CCN(CCCCCCCCC)CC(=O)N1CCC(OC(=O)CN(CCCCCCCCC)CCCCCCCCC)C1 |
| InChI | InChI=1S/C55H110N4O3/c1-6-11-16-21-26-31-36-42-56(43-37-32-27-22-17-12-7-2)48-49-58(46-40-35-30-25-20-15-10-5)51-54(60)59-47-41-53(50-59)62-55(61)52-57(44-38-33-28-23-18-13-8-3)45-39-34-29-24-19-14-9-4/h53H,6-52H2,1-5H3 |
| InChIKey | MPIGLAOZGWGEIE-UHFFFAOYSA-N |
| XLogP | 14.79 |
| TPSA | 56.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.51 |
| LogP ≤ 5 | 14.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|