C57H114N4O2 — CID 166893913
1-[2-[1-[2-[2-[di(nonyl)amino]ethyl-nonylamino]acetyl]piperidin-3-yl]ethyl-nonylamino]decan-4-one (PubChem CID 166893913) has the molecular formula C57H114N4O2 and a molecular weight of 887.56 g/mol. Its IUPAC name is 1-[2-[1-[2-[2-[di(nonyl)amino]ethyl-nonylamino]acetyl]piperidin-3-yl]ethyl-nonylamino]decan-4-one.
| Compound Name | 1-[2-[1-[2-[2-[di(nonyl)amino]ethyl-nonylamino]acetyl]piperidin-3-yl]ethyl-nonylamino]decan-4-one |
|---|---|
| PubChem CID | 166893913 |
| Molecular Formula | C57H114N4O2 |
| Molecular Weight | 887.56 g/mol |
| Exact Mass | 886.89 |
| IUPAC Name | 1-[2-[1-[2-[2-[di(nonyl)amino]ethyl-nonylamino]acetyl]piperidin-3-yl]ethyl-nonylamino]decan-4-one |
| SMILES | CCCCCCCCCN(CCCC(=O)CCCCCC)CCC1CCCN(C(=O)CN(CCCCCCCCC)CCN(CCCCCCCCC)CCCCCCCCC)C1 |
| InChI | InChI=1S/C57H114N4O2/c1-6-11-16-21-25-29-34-44-58(48-39-42-56(62)41-33-20-15-10-5)50-43-55-40-38-49-61(53-55)57(63)54-60(47-37-32-28-24-19-14-9-4)52-51-59(45-35-30-26-22-17-12-7-2)46-36-31-27-23-18-13-8-3/h55H,6-54H2,1-5H3 |
| InChIKey | SQOZCUGLXIGURC-UHFFFAOYSA-N |
| XLogP | 15.84 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.56 |
| LogP ≤ 5 | 15.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|