C20H42N2O — CID 176968729
ethane;1-(4-ethylpiperidin-1-yl)-2-[hexyl(propyl)amino]ethanone (PubChem CID 176968729) has the molecular formula C20H42N2O and a molecular weight of 326.57 g/mol. Its IUPAC name is ethane;1-(4-ethylpiperidin-1-yl)-2-[hexyl(propyl)amino]ethanone.
| Compound Name | ethane;1-(4-ethylpiperidin-1-yl)-2-[hexyl(propyl)amino]ethanone |
|---|---|
| PubChem CID | 176968729 |
| Molecular Formula | C20H42N2O |
| Molecular Weight | 326.57 g/mol |
| Exact Mass | 326.33 |
| IUPAC Name | ethane;1-(4-ethylpiperidin-1-yl)-2-[hexyl(propyl)amino]ethanone |
| SMILES | CC.CCCCCCN(CCC)CC(=O)N1CCC(CC)CC1 |
| InChI | InChI=1S/C18H36N2O.C2H6/c1-4-7-8-9-13-19(12-5-2)16-18(21)20-14-10-17(6-3)11-15-20;1-2/h17H,4-16H2,1-3H3;1-2H3 |
| InChIKey | HDGFEHSRAZWIMU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|