C57H116N4O3 — CID 170755063
2-[2-[di(nonyl)amino]ethyl-nonylamino]-1-[4-(methoxymethyl)piperidin-1-yl]ethanone;2-[nonyl(octyl)amino]acetaldehyde (PubChem CID 170755063) has the molecular formula C57H116N4O3 and a molecular weight of 905.58 g/mol. Its IUPAC name is 2-[2-[di(nonyl)amino]ethyl-nonylamino]-1-[4-(methoxymethyl)piperidin-1-yl]ethanone;2-[nonyl(octyl)amino]acetaldehyde.
| Compound Name | 2-[2-[di(nonyl)amino]ethyl-nonylamino]-1-[4-(methoxymethyl)piperidin-1-yl]ethanone;2-[nonyl(octyl)amino]acetaldehyde |
|---|---|
| PubChem CID | 170755063 |
| Molecular Formula | C57H116N4O3 |
| Molecular Weight | 905.58 g/mol |
| Exact Mass | 904.90 |
| IUPAC Name | 2-[2-[di(nonyl)amino]ethyl-nonylamino]-1-[4-(methoxymethyl)piperidin-1-yl]ethanone;2-[nonyl(octyl)amino]acetaldehyde |
| SMILES | CCCCCCCCCN(CC=O)CCCCCCCC.CCCCCCCCCN(CCCCCCCCC)CCN(CCCCCCCCC)CC(=O)N1CCC(COC)CC1 |
| InChI | InChI=1S/C38H77N3O2.C19H39NO/c1-5-8-11-14-17-20-23-28-39(29-24-21-18-15-12-9-6-2)33-34-40(30-25-22-19-16-13-10-7-3)35-38(42)41-31-26-37(27-32-41)36-43-4;1-3-5-7-9-11-13-15-17-20(18-19-21)16-14-12-10-8-6-4-2/h37H,5-36H2,1-4H3;19H,3-18H2,1-2H3 |
| InChIKey | YYCIPRVDYHBDJY-UHFFFAOYSA-N |
| XLogP | 15.33 |
| TPSA | 56.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.58 |
| LogP ≤ 5 | 15.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|