C57H117N5O4 — CID 171538815
4-[2-[2-[di(nonyl)amino]ethyl-nonylamino]acetyl]piperazine-1-carbaldehyde;6-[ethyl(nonyl)amino]hexanal;1-methoxypropane (PubChem CID 171538815) has the molecular formula C57H117N5O4 and a molecular weight of 936.59 g/mol. Its IUPAC name is 4-[2-[2-[di(nonyl)amino]ethyl-nonylamino]acetyl]piperazine-1-carbaldehyde;6-[ethyl(nonyl)amino]hexanal;1-methoxypropane.
| Compound Name | 4-[2-[2-[di(nonyl)amino]ethyl-nonylamino]acetyl]piperazine-1-carbaldehyde;6-[ethyl(nonyl)amino]hexanal;1-methoxypropane |
|---|---|
| PubChem CID | 171538815 |
| Molecular Formula | C57H117N5O4 |
| Molecular Weight | 936.59 g/mol |
| Exact Mass | 935.91 |
| IUPAC Name | 4-[2-[2-[di(nonyl)amino]ethyl-nonylamino]acetyl]piperazine-1-carbaldehyde;6-[ethyl(nonyl)amino]hexanal;1-methoxypropane |
| SMILES | CCCCCCCCCN(CC)CCCCCC=O.CCCCCCCCCN(CCCCCCCCC)CCN(CCCCCCCCC)CC(=O)N1CCN(C=O)CC1.CCCOC |
| InChI | InChI=1S/C36H72N4O2.C17H35NO.C4H10O/c1-4-7-10-13-16-19-22-25-37(26-23-20-17-14-11-8-5-2)28-29-38(27-24-21-18-15-12-9-6-3)34-36(42)40-32-30-39(35-41)31-33-40;1-3-5-6-7-8-9-12-15-18(4-2)16-13-10-11-14-17-19;1-3-4-5-2/h35H,4-34H2,1-3H3;17H,3-16H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | LCISAAPQSUNMIJ-UHFFFAOYSA-N |
| XLogP | 14.00 |
| TPSA | 76.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 936.59 |
| LogP ≤ 5 | 14.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|