C53H106N4O6 — CID 170754847
4-[decyl-[5-[4-[5-[decyl(octyl)amino]pentanoyl]piperazin-1-yl]-5-oxopentyl]amino]butanal;formic acid;1-methoxypentane (PubChem CID 170754847) has the molecular formula C53H106N4O6 and a molecular weight of 895.45 g/mol. Its IUPAC name is 4-[decyl-[5-[4-[5-[decyl(octyl)amino]pentanoyl]piperazin-1-yl]-5-oxopentyl]amino]butanal;formic acid;1-methoxypentane.
| Compound Name | 4-[decyl-[5-[4-[5-[decyl(octyl)amino]pentanoyl]piperazin-1-yl]-5-oxopentyl]amino]butanal;formic acid;1-methoxypentane |
|---|---|
| PubChem CID | 170754847 |
| Molecular Formula | C53H106N4O6 |
| Molecular Weight | 895.45 g/mol |
| Exact Mass | 894.81 |
| IUPAC Name | 4-[decyl-[5-[4-[5-[decyl(octyl)amino]pentanoyl]piperazin-1-yl]-5-oxopentyl]amino]butanal;formic acid;1-methoxypentane |
| SMILES | CCCCCCCCCCN(CCCC=O)CCCCC(=O)N1CCN(C(=O)CCCCN(CCCCCCCC)CCCCCCCCCC)CC1.CCCCCOC.O=CO |
| InChI | InChI=1S/C46H90N4O3.C6H14O.CH2O2/c1-4-7-10-13-16-18-21-26-35-47(34-25-20-15-12-9-6-3)37-28-23-32-45(52)49-40-42-50(43-41-49)46(53)33-24-29-38-48(39-30-31-44-51)36-27-22-19-17-14-11-8-5-2;1-3-4-5-6-7-2;2-1-3/h44H,4-43H2,1-3H3;3-6H2,1-2H3;1H,(H,2,3) |
| InChIKey | GPVOLPNBZPKOPP-UHFFFAOYSA-N |
| XLogP | 12.75 |
| TPSA | 110.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.45 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|