C48H93N4O3+ — CID 168924452
pentyl 4-[decyl-[5-[4-[5-[decyl(pent-4-enyl)amino]pentanoyl]piperazin-1-ium-1-ylidene]pentyl]amino]butanoate (PubChem CID 168924452) has the molecular formula C48H93N4O3+ and a molecular weight of 774.30 g/mol. Its IUPAC name is pentyl 4-[decyl-[5-[4-[5-[decyl(pent-4-enyl)amino]pentanoyl]piperazin-1-ium-1-ylidene]pentyl]amino]butanoate.
| Compound Name | pentyl 4-[decyl-[5-[4-[5-[decyl(pent-4-enyl)amino]pentanoyl]piperazin-1-ium-1-ylidene]pentyl]amino]butanoate |
|---|---|
| PubChem CID | 168924452 |
| Molecular Formula | C48H93N4O3+ |
| Molecular Weight | 774.30 g/mol |
| Exact Mass | 773.72 |
| IUPAC Name | pentyl 4-[decyl-[5-[4-[5-[decyl(pent-4-enyl)amino]pentanoyl]piperazin-1-ium-1-ylidene]pentyl]amino]butanoate |
| SMILES | C=CCCCN(CCCCCCCCCC)CCCCC(=O)N1CC[N+](=CCCCCN(CCCCCCCCCC)CCCC(=O)OCCCCC)CC1 |
| InChI | InChI=1S/C48H93N4O3/c1-5-9-13-15-17-19-21-26-36-49(35-25-11-7-3)40-30-24-33-47(53)52-44-42-51(43-45-52)39-29-23-28-38-50(37-27-22-20-18-16-14-10-6-2)41-32-34-48(54)55-46-31-12-8-4/h7,39H,3,5-6,8-38,40-46H2,1-2,4H3/q+1 |
| InChIKey | RTVMJYYBCMGFCP-UHFFFAOYSA-N |
| XLogP | 11.62 |
| TPSA | 56.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.30 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|