C64H125N5O4 — CID 156535870
3-[[2-[4-[2-[2-[di(nonyl)amino]ethyl-nonylamino]acetyl]piperazin-1-yl]-2-oxoethyl]-tetradec-9-enylamino]propyl decanoate (PubChem CID 156535870) has the molecular formula C64H125N5O4 and a molecular weight of 1028.73 g/mol. Its IUPAC name is 3-[[2-[4-[2-[2-[di(nonyl)amino]ethyl-nonylamino]acetyl]piperazin-1-yl]-2-oxoethyl]-tetradec-9-enylamino]propyl decanoate.
| Compound Name | 3-[[2-[4-[2-[2-[di(nonyl)amino]ethyl-nonylamino]acetyl]piperazin-1-yl]-2-oxoethyl]-tetradec-9-enylamino]propyl decanoate |
|---|---|
| PubChem CID | 156535870 |
| Molecular Formula | C64H125N5O4 |
| Molecular Weight | 1028.73 g/mol |
| Exact Mass | 1027.97 |
| IUPAC Name | 3-[[2-[4-[2-[2-[di(nonyl)amino]ethyl-nonylamino]acetyl]piperazin-1-yl]-2-oxoethyl]-tetradec-9-enylamino]propyl decanoate |
| SMILES | CCCCC=CCCCCCCCCN(CCCOC(=O)CCCCCCCCC)CC(=O)N1CCN(C(=O)CN(CCCCCCCCC)CCN(CCCCCCCCC)CCCCCCCCC)CC1 |
| InChI | InChI=1S/C64H125N5O4/c1-6-11-16-21-26-27-28-29-30-35-40-44-50-66(52-46-59-73-64(72)47-41-36-31-22-17-12-7-2)60-62(70)68-55-57-69(58-56-68)63(71)61-67(51-45-39-34-25-20-15-10-5)54-53-65(48-42-37-32-23-18-13-8-3)49-43-38-33-24-19-14-9-4/h21,26H,6-20,22-25,27-61H2,1-5H3 |
| InChIKey | FBDVZNPKHBUHIK-UHFFFAOYSA-N |
| XLogP | 16.37 |
| TPSA | 76.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 55 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1028.73 |
| LogP ≤ 5 | 16.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|