C32H49IN2O10 — CID 58338993
(2R)-7-(4-iodophenyl)-4-oxo-2-[3-oxo-3-[2-[2-[2-oxo-5-[2-[2-oxo-2-(propylamino)ethoxy]ethoxy]pentoxy]ethoxy]ethylamino]propyl]heptanoic acid (PubChem CID 58338993) has the molecular formula C32H49IN2O10 and a molecular weight of 748.65 g/mol. Its IUPAC name is (2R)-7-(4-iodophenyl)-4-oxo-2-[3-oxo-3-[2-[2-[2-oxo-5-[2-[2-oxo-2-(propylamino)ethoxy]ethoxy]pentoxy]ethoxy]ethylamino]propyl]heptanoic acid.
| Compound Name | (2R)-7-(4-iodophenyl)-4-oxo-2-[3-oxo-3-[2-[2-[2-oxo-5-[2-[2-oxo-2-(propylamino)ethoxy]ethoxy]pentoxy]ethoxy]ethylamino]propyl]heptanoic acid |
|---|---|
| PubChem CID | 58338993 |
| Molecular Formula | C32H49IN2O10 |
| Molecular Weight | 748.65 g/mol |
| Exact Mass | 748.24 |
| IUPAC Name | (2R)-7-(4-iodophenyl)-4-oxo-2-[3-oxo-3-[2-[2-[2-oxo-5-[2-[2-oxo-2-(propylamino)ethoxy]ethoxy]pentoxy]ethoxy]ethylamino]propyl]heptanoic acid |
| SMILES | CCCNC(=O)COCCOCCCC(=O)COCCOCCNC(=O)CC[C@H](CC(=O)CCCc1ccc(I)cc1)C(=O)O |
| InChI | InChI=1S/C32H49IN2O10/c1-2-14-34-31(39)24-45-21-18-42-16-4-7-29(37)23-44-20-19-43-17-15-35-30(38)13-10-26(32(40)41)22-28(36)6-3-5-25-8-11-27(33)12-9-25/h8-9,11-12,26H,2-7,10,13-24H2,1H3,(H,34,39)(H,35,38)(H,40,41)/t26-/m1/s1 |
| InChIKey | SRPOTXOYZAUOEC-AREMUKBSSA-N |
| XLogP | 3.11 |
| TPSA | 166.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.65 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|