C36H57NO12 — CID 158737438
4-[(12R)-12-carboxy-15-[2-[2-[5-(2-ethoxyethoxy)-2-oxopentoxy]ethoxy]ethylamino]-10,15-dioxopentadecoxy]benzoic acid (PubChem CID 158737438) has the molecular formula C36H57NO12 and a molecular weight of 695.85 g/mol. Its IUPAC name is 4-[(12R)-12-carboxy-15-[2-[2-[5-(2-ethoxyethoxy)-2-oxopentoxy]ethoxy]ethylamino]-10,15-dioxopentadecoxy]benzoic acid.
| Compound Name | 4-[(12R)-12-carboxy-15-[2-[2-[5-(2-ethoxyethoxy)-2-oxopentoxy]ethoxy]ethylamino]-10,15-dioxopentadecoxy]benzoic acid |
|---|---|
| PubChem CID | 158737438 |
| Molecular Formula | C36H57NO12 |
| Molecular Weight | 695.85 g/mol |
| Exact Mass | 695.39 |
| IUPAC Name | 4-[(12R)-12-carboxy-15-[2-[2-[5-(2-ethoxyethoxy)-2-oxopentoxy]ethoxy]ethylamino]-10,15-dioxopentadecoxy]benzoic acid |
| SMILES | CCOCCOCCCC(=O)COCCOCCNC(=O)CC[C@H](CC(=O)CCCCCCCCCOc1ccc(C(=O)O)cc1)C(=O)O |
| InChI | InChI=1S/C36H57NO12/c1-2-45-23-24-46-20-10-12-32(39)28-48-26-25-47-22-19-37-34(40)18-15-30(36(43)44)27-31(38)11-8-6-4-3-5-7-9-21-49-33-16-13-29(14-17-33)35(41)42/h13-14,16-17,30H,2-12,15,18-28H2,1H3,(H,37,40)(H,41,42)(H,43,44)/t30-/m1/s1 |
| InChIKey | AYDZWWWITUENCG-SSEXGKCCSA-N |
| XLogP | 4.88 |
| TPSA | 183.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.85 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|