C36H55NO13 — CID 157398356
3-[(11R)-11-carboxy-9,14-dioxo-14-[2-[2-[2-oxo-5-[2-(2-oxopropoxy)ethoxy]pentoxy]ethoxy]ethylamino]tetradecoxy]benzoic acid (PubChem CID 157398356) has the molecular formula C36H55NO13 and a molecular weight of 709.83 g/mol. Its IUPAC name is 3-[(11R)-11-carboxy-9,14-dioxo-14-[2-[2-[2-oxo-5-[2-(2-oxopropoxy)ethoxy]pentoxy]ethoxy]ethylamino]tetradecoxy]benzoic acid.
| Compound Name | 3-[(11R)-11-carboxy-9,14-dioxo-14-[2-[2-[2-oxo-5-[2-(2-oxopropoxy)ethoxy]pentoxy]ethoxy]ethylamino]tetradecoxy]benzoic acid |
|---|---|
| PubChem CID | 157398356 |
| Molecular Formula | C36H55NO13 |
| Molecular Weight | 709.83 g/mol |
| Exact Mass | 709.37 |
| IUPAC Name | 3-[(11R)-11-carboxy-9,14-dioxo-14-[2-[2-[2-oxo-5-[2-(2-oxopropoxy)ethoxy]pentoxy]ethoxy]ethylamino]tetradecoxy]benzoic acid |
| SMILES | CC(=O)COCCOCCCC(=O)COCCOCCNC(=O)CC[C@H](CC(=O)CCCCCCCCOc1cccc(C(=O)O)c1)C(=O)O |
| InChI | InChI=1S/C36H55NO13/c1-28(38)26-48-22-20-46-17-9-12-32(40)27-49-23-21-47-19-16-37-34(41)15-14-30(36(44)45)24-31(39)11-6-4-2-3-5-7-18-50-33-13-8-10-29(25-33)35(42)43/h8,10,13,25,30H,2-7,9,11-12,14-24,26-27H2,1H3,(H,37,41)(H,42,43)(H,44,45)/t30-/m1/s1 |
| InChIKey | JNQDUVPFTSETPB-SSEXGKCCSA-N |
| XLogP | 4.06 |
| TPSA | 201.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.83 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|