C37H57NO13 — CID 58339025
4-[10-[2-[2-[5-[2-[(4R)-4-carboxy-2,7-dioxooctoxy]ethoxy]-2-oxopentoxy]ethoxy]ethylamino]-10-oxodecoxy]benzoic acid (PubChem CID 58339025) has the molecular formula C37H57NO13 and a molecular weight of 723.86 g/mol. Its IUPAC name is 4-[10-[2-[2-[5-[2-[(4R)-4-carboxy-2,7-dioxooctoxy]ethoxy]-2-oxopentoxy]ethoxy]ethylamino]-10-oxodecoxy]benzoic acid.
| Compound Name | 4-[10-[2-[2-[5-[2-[(4R)-4-carboxy-2,7-dioxooctoxy]ethoxy]-2-oxopentoxy]ethoxy]ethylamino]-10-oxodecoxy]benzoic acid |
|---|---|
| PubChem CID | 58339025 |
| Molecular Formula | C37H57NO13 |
| Molecular Weight | 723.86 g/mol |
| Exact Mass | 723.38 |
| IUPAC Name | 4-[10-[2-[2-[5-[2-[(4R)-4-carboxy-2,7-dioxooctoxy]ethoxy]-2-oxopentoxy]ethoxy]ethylamino]-10-oxodecoxy]benzoic acid |
| SMILES | CC(=O)CC[C@H](CC(=O)COCCOCCCC(=O)COCCOCCNC(=O)CCCCCCCCCOc1ccc(C(=O)O)cc1)C(=O)O |
| InChI | InChI=1S/C37H57NO13/c1-29(39)12-13-31(37(45)46)26-33(41)28-50-24-22-47-19-9-10-32(40)27-49-25-23-48-21-18-38-35(42)11-7-5-3-2-4-6-8-20-51-34-16-14-30(15-17-34)36(43)44/h14-17,31H,2-13,18-28H2,1H3,(H,38,42)(H,43,44)(H,45,46)/t31-/m1/s1 |
| InChIKey | SEBPEPLMNOUSAO-WJOKGBTCSA-N |
| XLogP | 4.45 |
| TPSA | 201.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.86 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|