C22H33ClIN3O6 — CID 174055126
4-amino-5-[[6-[4-(4-iodophenyl)butanoylamino]-1-methoxy-1-oxohexan-2-yl]amino]-5-oxopentanoic acid;hydrochloride (PubChem CID 174055126) has the molecular formula C22H33ClIN3O6 and a molecular weight of 597.88 g/mol. Its IUPAC name is 4-amino-5-[[6-[4-(4-iodophenyl)butanoylamino]-1-methoxy-1-oxohexan-2-yl]amino]-5-oxopentanoic acid;hydrochloride.
| Compound Name | 4-amino-5-[[6-[4-(4-iodophenyl)butanoylamino]-1-methoxy-1-oxohexan-2-yl]amino]-5-oxopentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 174055126 |
| Molecular Formula | C22H33ClIN3O6 |
| Molecular Weight | 597.88 g/mol |
| Exact Mass | 597.11 |
| IUPAC Name | 4-amino-5-[[6-[4-(4-iodophenyl)butanoylamino]-1-methoxy-1-oxohexan-2-yl]amino]-5-oxopentanoic acid;hydrochloride |
| SMILES | COC(=O)C(CCCCNC(=O)CCCc1ccc(I)cc1)NC(=O)C(N)CCC(=O)O.Cl |
| InChI | InChI=1S/C22H32IN3O6.ClH/c1-32-22(31)18(26-21(30)17(24)12-13-20(28)29)6-2-3-14-25-19(27)7-4-5-15-8-10-16(23)11-9-15;/h8-11,17-18H,2-7,12-14,24H2,1H3,(H,25,27)(H,26,30)(H,28,29);1H |
| InChIKey | SSUJNDZNJCCKHR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.88 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|