C37H68N4O6 — CID 176691701
tert-butyl 2-[[2-amino-6-(tert-butylamino)hexanoyl]amino]-6-[4-[4-(2-methylpropyl)phenyl]butanoylamino]hexanoate;ethane;formic acid (PubChem CID 176691701) has the molecular formula C37H68N4O6 and a molecular weight of 664.97 g/mol. Its IUPAC name is tert-butyl 2-[[2-amino-6-(tert-butylamino)hexanoyl]amino]-6-[4-[4-(2-methylpropyl)phenyl]butanoylamino]hexanoate;ethane;formic acid.
| Compound Name | tert-butyl 2-[[2-amino-6-(tert-butylamino)hexanoyl]amino]-6-[4-[4-(2-methylpropyl)phenyl]butanoylamino]hexanoate;ethane;formic acid |
|---|---|
| PubChem CID | 176691701 |
| Molecular Formula | C37H68N4O6 |
| Molecular Weight | 664.97 g/mol |
| Exact Mass | 664.51 |
| IUPAC Name | tert-butyl 2-[[2-amino-6-(tert-butylamino)hexanoyl]amino]-6-[4-[4-(2-methylpropyl)phenyl]butanoylamino]hexanoate;ethane;formic acid |
| SMILES | CC.CC(C)Cc1ccc(CCCC(=O)NCCCCC(NC(=O)C(N)CCCCNC(C)(C)C)C(=O)OC(C)(C)C)cc1.O=CO |
| InChI | InChI=1S/C34H60N4O4.C2H6.CH2O2/c1-25(2)24-27-20-18-26(19-21-27)14-13-17-30(39)36-22-11-10-16-29(32(41)42-34(6,7)8)38-31(40)28(35)15-9-12-23-37-33(3,4)5;1-2;2-1-3/h18-21,25,28-29,37H,9-17,22-24,35H2,1-8H3,(H,36,39)(H,38,40);1-2H3;1H,(H,2,3) |
| InChIKey | VJNUUTVSKKIUSN-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 159.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.97 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|