C36H61N3O8Sn — CID 140828337
ditert-butyl (2S)-2-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-5-[4-(4-trimethylstannylphenyl)butanoylamino]pentan-2-yl]carbamoylamino]pentanedioate (PubChem CID 140828337) has the molecular formula C36H61N3O8Sn and a molecular weight of 782.61 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-5-[4-(4-trimethylstannylphenyl)butanoylamino]pentan-2-yl]carbamoylamino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-5-[4-(4-trimethylstannylphenyl)butanoylamino]pentan-2-yl]carbamoylamino]pentanedioate |
|---|---|
| PubChem CID | 140828337 |
| Molecular Formula | C36H61N3O8Sn |
| Molecular Weight | 782.61 g/mol |
| Exact Mass | 783.35 |
| IUPAC Name | ditert-butyl (2S)-2-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-5-[4-(4-trimethylstannylphenyl)butanoylamino]pentan-2-yl]carbamoylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)N[C@@H](CCCNC(=O)CCCc1ccc([Sn](C)(C)C)cc1)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H52N3O8.3CH3.Sn/c1-31(2,3)42-27(38)21-20-25(29(40)44-33(7,8)9)36-30(41)35-24(28(39)43-32(4,5)6)18-14-22-34-26(37)19-13-17-23-15-11-10-12-16-23;;;;/h11-12,15-16,24-25H,13-14,17-22H2,1-9H3,(H,34,37)(H2,35,36,41);3*1H3;/t24-,25-;;;;/m0..../s1 |
| InChIKey | DFVZTYZTCGZGHZ-GDMSDNAHSA-N |
| XLogP | 5.29 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.61 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|