C23H43N3O8 — CID 169158995
tert-butyl formate;ditert-butyl 2-[(4-amino-4-oxobutyl)carbamoylamino]pentanedioate (PubChem CID 169158995) has the molecular formula C23H43N3O8 and a molecular weight of 489.61 g/mol. Its IUPAC name is tert-butyl formate;ditert-butyl 2-[(4-amino-4-oxobutyl)carbamoylamino]pentanedioate.
| Compound Name | tert-butyl formate;ditert-butyl 2-[(4-amino-4-oxobutyl)carbamoylamino]pentanedioate |
|---|---|
| PubChem CID | 169158995 |
| Molecular Formula | C23H43N3O8 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.31 |
| IUPAC Name | tert-butyl formate;ditert-butyl 2-[(4-amino-4-oxobutyl)carbamoylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CCC(NC(=O)NCCCC(N)=O)C(=O)OC(C)(C)C.CC(C)(C)OC=O |
| InChI | InChI=1S/C18H33N3O6.C5H10O2/c1-17(2,3)26-14(23)10-9-12(15(24)27-18(4,5)6)21-16(25)20-11-7-8-13(19)22;1-5(2,3)7-4-6/h12H,7-11H2,1-6H3,(H2,19,22)(H2,20,21,25);4H,1-3H3 |
| InChIKey | GPMSMXHQEOESRV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 163.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|