C42H79N5O11 — CID 145300742
tert-butyl formate;ditert-butyl 2-[[6-[[8-(5-aminopentylamino)-8-oxooctanoyl]amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate (PubChem CID 145300742) has the molecular formula C42H79N5O11 and a molecular weight of 830.12 g/mol. Its IUPAC name is tert-butyl formate;ditert-butyl 2-[[6-[[8-(5-aminopentylamino)-8-oxooctanoyl]amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate.
| Compound Name | tert-butyl formate;ditert-butyl 2-[[6-[[8-(5-aminopentylamino)-8-oxooctanoyl]amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate |
|---|---|
| PubChem CID | 145300742 |
| Molecular Formula | C42H79N5O11 |
| Molecular Weight | 830.12 g/mol |
| Exact Mass | 829.58 |
| IUPAC Name | tert-butyl formate;ditert-butyl 2-[[6-[[8-(5-aminopentylamino)-8-oxooctanoyl]amino]-1-[(2-methylpropan-2-yl)oxy]-1-oxohexan-2-yl]carbamoylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CCC(NC(=O)NC(CCCCNC(=O)CCCCCCC(=O)NCCCCCN)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C.CC(C)(C)OC=O |
| InChI | InChI=1S/C37H69N5O9.C5H10O2/c1-35(2,3)49-31(45)23-22-28(33(47)51-37(7,8)9)42-34(48)41-27(32(46)50-36(4,5)6)19-15-18-26-40-30(44)21-14-11-10-13-20-29(43)39-25-17-12-16-24-38;1-5(2,3)7-4-6/h27-28H,10-26,38H2,1-9H3,(H,39,43)(H,40,44)(H2,41,42,48);4H,1-3H3 |
| InChIKey | QIFRKHAMJQLQAI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 230.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.12 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|