C40H75N5O8 — CID 138627604
ditert-butyl (2S)-2-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-7-(11-piperazin-1-ylundecanoylamino)heptan-2-yl]carbamoylamino]pentanedioate (PubChem CID 138627604) has the molecular formula C40H75N5O8 and a molecular weight of 754.07 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-7-(11-piperazin-1-ylundecanoylamino)heptan-2-yl]carbamoylamino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-7-(11-piperazin-1-ylundecanoylamino)heptan-2-yl]carbamoylamino]pentanedioate |
|---|---|
| PubChem CID | 138627604 |
| Molecular Formula | C40H75N5O8 |
| Molecular Weight | 754.07 g/mol |
| Exact Mass | 753.56 |
| IUPAC Name | ditert-butyl (2S)-2-[[(2S)-1-[(2-methylpropan-2-yl)oxy]-1-oxo-7-(11-piperazin-1-ylundecanoylamino)heptan-2-yl]carbamoylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)N[C@@H](CCCCCNC(=O)CCCCCCCCCCN1CCNCC1)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C40H75N5O8/c1-38(2,3)51-34(47)24-23-32(36(49)53-40(7,8)9)44-37(50)43-31(35(48)52-39(4,5)6)21-17-16-19-25-42-33(46)22-18-14-12-10-11-13-15-20-28-45-29-26-41-27-30-45/h31-32,41H,10-30H2,1-9H3,(H,42,46)(H2,43,44,50)/t31-,32-/m0/s1 |
| InChIKey | NZZSTWNMUHWUNJ-ACHIHNKUSA-N |
| XLogP | 5.92 |
| TPSA | 164.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.07 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|