C9H16BrNO3 — CID 118167390
6-[(2-bromoacetyl)amino]-2-methylhexanoic acid (PubChem CID 118167390) has the molecular formula C9H16BrNO3 and a molecular weight of 266.13 g/mol. Its IUPAC name is 6-[(2-bromoacetyl)amino]-2-methylhexanoic acid.
| Compound Name | 6-[(2-bromoacetyl)amino]-2-methylhexanoic acid |
|---|---|
| PubChem CID | 118167390 |
| Molecular Formula | C9H16BrNO3 |
| Molecular Weight | 266.13 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 6-[(2-bromoacetyl)amino]-2-methylhexanoic acid |
| SMILES | CC(CCCCNC(=O)CBr)C(=O)O |
| InChI | InChI=1S/C9H16BrNO3/c1-7(9(13)14)4-2-3-5-11-8(12)6-10/h7H,2-6H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | IWIWGHVNCQSSCZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.13 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|