C12H21BrClN3O3 — CID 118136977
(2S)-5-[(2-bromoacetyl)amino]-N-[2-[(2-chloroacetyl)amino]ethyl]-2-methylpentanamide (PubChem CID 118136977) has the molecular formula C12H21BrClN3O3 and a molecular weight of 370.68 g/mol. Its IUPAC name is (2S)-5-[(2-bromoacetyl)amino]-N-[2-[(2-chloroacetyl)amino]ethyl]-2-methylpentanamide.
| Compound Name | (2S)-5-[(2-bromoacetyl)amino]-N-[2-[(2-chloroacetyl)amino]ethyl]-2-methylpentanamide |
|---|---|
| PubChem CID | 118136977 |
| Molecular Formula | C12H21BrClN3O3 |
| Molecular Weight | 370.68 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | (2S)-5-[(2-bromoacetyl)amino]-N-[2-[(2-chloroacetyl)amino]ethyl]-2-methylpentanamide |
| SMILES | C[C@@H](CCCNC(=O)CBr)C(=O)NCCNC(=O)CCl |
| InChI | InChI=1S/C12H21BrClN3O3/c1-9(3-2-4-15-10(18)7-13)12(20)17-6-5-16-11(19)8-14/h9H,2-8H2,1H3,(H,15,18)(H,16,19)(H,17,20)/t9-/m0/s1 |
| InChIKey | NXSGOUBCPMSJSE-VIFPVBQESA-N |
| XLogP | 0.38 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.68 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|