C13H21ClI2N4O4 — CID 89037484
(2S)-N-[2-[(2-chloroacetyl)amino]ethyl]-2,5-bis[(2-iodoacetyl)amino]pentanamide (PubChem CID 89037484) has the molecular formula C13H21ClI2N4O4 and a molecular weight of 586.60 g/mol. Its IUPAC name is (2S)-N-[2-[(2-chloroacetyl)amino]ethyl]-2,5-bis[(2-iodoacetyl)amino]pentanamide.
| Compound Name | (2S)-N-[2-[(2-chloroacetyl)amino]ethyl]-2,5-bis[(2-iodoacetyl)amino]pentanamide |
|---|---|
| PubChem CID | 89037484 |
| Molecular Formula | C13H21ClI2N4O4 |
| Molecular Weight | 586.60 g/mol |
| Exact Mass | 585.93 |
| IUPAC Name | (2S)-N-[2-[(2-chloroacetyl)amino]ethyl]-2,5-bis[(2-iodoacetyl)amino]pentanamide |
| SMILES | O=C(CCl)NCCNC(=O)[C@H](CCCNC(=O)CI)NC(=O)CI |
| InChI | InChI=1S/C13H21ClI2N4O4/c14-6-10(21)18-4-5-19-13(24)9(20-12(23)8-16)2-1-3-17-11(22)7-15/h9H,1-8H2,(H,17,22)(H,18,21)(H,19,24)(H,20,23)/t9-/m0/s1 |
| InChIKey | YSLRCAOVUHTQFB-VIFPVBQESA-N |
| XLogP | -0.29 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.60 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|