C16H29ClN4O4 — CID 123782066
2,4-bis(butanoylamino)-N-[2-[(2-chloroacetyl)amino]ethyl]butanamide (PubChem CID 123782066) has the molecular formula C16H29ClN4O4 and a molecular weight of 376.89 g/mol. Its IUPAC name is 2,4-bis(butanoylamino)-N-[2-[(2-chloroacetyl)amino]ethyl]butanamide.
| Compound Name | 2,4-bis(butanoylamino)-N-[2-[(2-chloroacetyl)amino]ethyl]butanamide |
|---|---|
| PubChem CID | 123782066 |
| Molecular Formula | C16H29ClN4O4 |
| Molecular Weight | 376.89 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2,4-bis(butanoylamino)-N-[2-[(2-chloroacetyl)amino]ethyl]butanamide |
| SMILES | CCCC(=O)NCCC(NC(=O)CCC)C(=O)NCCNC(=O)CCl |
| InChI | InChI=1S/C16H29ClN4O4/c1-3-5-13(22)18-8-7-12(21-14(23)6-4-2)16(25)20-10-9-19-15(24)11-17/h12H,3-11H2,1-2H3,(H,18,22)(H,19,24)(H,20,25)(H,21,23) |
| InChIKey | WMQNGSWRVYWMCO-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.89 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|