C7H13F2NO — CID 147098310
N-(3,3-difluoropropyl)butanamide (PubChem CID 147098310) has the molecular formula C7H13F2NO and a molecular weight of 165.18 g/mol. Its IUPAC name is N-(3,3-difluoropropyl)butanamide.
| Compound Name | N-(3,3-difluoropropyl)butanamide |
|---|---|
| PubChem CID | 147098310 |
| Molecular Formula | C7H13F2NO |
| Molecular Weight | 165.18 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | N-(3,3-difluoropropyl)butanamide |
| SMILES | CCCC(=O)NCCC(F)F |
| InChI | InChI=1S/C7H13F2NO/c1-2-3-7(11)10-5-4-6(8)9/h6H,2-5H2,1H3,(H,10,11) |
| InChIKey | BKDWTDLSMLUACW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.18 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |