C19H35Cl2N7O5 — CID 101090040
(2S)-N-[(2S)-1-[(3-amino-3-oxopropyl)amino]-6-hydrazinyl-1-oxohexan-2-yl]-2,6-bis[(2-chloroacetyl)amino]hexanamide (PubChem CID 101090040) has the molecular formula C19H35Cl2N7O5 and a molecular weight of 512.44 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-[(3-amino-3-oxopropyl)amino]-6-hydrazinyl-1-oxohexan-2-yl]-2,6-bis[(2-chloroacetyl)amino]hexanamide.
| Compound Name | (2S)-N-[(2S)-1-[(3-amino-3-oxopropyl)amino]-6-hydrazinyl-1-oxohexan-2-yl]-2,6-bis[(2-chloroacetyl)amino]hexanamide |
|---|---|
| PubChem CID | 101090040 |
| Molecular Formula | C19H35Cl2N7O5 |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | (2S)-N-[(2S)-1-[(3-amino-3-oxopropyl)amino]-6-hydrazinyl-1-oxohexan-2-yl]-2,6-bis[(2-chloroacetyl)amino]hexanamide |
| SMILES | NNCCCC[C@H](NC(=O)[C@H](CCCCNC(=O)CCl)NC(=O)CCl)C(=O)NCCC(N)=O |
| InChI | InChI=1S/C19H35Cl2N7O5/c20-11-16(30)24-8-3-1-6-14(27-17(31)12-21)19(33)28-13(5-2-4-9-26-23)18(32)25-10-7-15(22)29/h13-14,26H,1-12,23H2,(H2,22,29)(H,24,30)(H,25,32)(H,27,31)(H,28,33)/t13-,14-/m0/s1 |
| InChIKey | AUCMPVPIRPSONT-KBPBESRZSA-N |
| XLogP | -1.65 |
| TPSA | 197.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|