C9H18INO3 — CID 138744973
N-(6,6-dihydroxy-5-methylhexyl)-2-iodoacetamide (PubChem CID 138744973) has the molecular formula C9H18INO3 and a molecular weight of 315.15 g/mol. Its IUPAC name is N-(6,6-dihydroxy-5-methylhexyl)-2-iodoacetamide.
| Compound Name | N-(6,6-dihydroxy-5-methylhexyl)-2-iodoacetamide |
|---|---|
| PubChem CID | 138744973 |
| Molecular Formula | C9H18INO3 |
| Molecular Weight | 315.15 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | N-(6,6-dihydroxy-5-methylhexyl)-2-iodoacetamide |
| SMILES | CC(CCCCNC(=O)CI)C(O)O |
| InChI | InChI=1S/C9H18INO3/c1-7(9(13)14)4-2-3-5-11-8(12)6-10/h7,9,13-14H,2-6H2,1H3,(H,11,12) |
| InChIKey | JRSWOMJZAPBWME-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.15 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|