C13H23IN2O3 — CID 174947831
6-[(2-iodoacetyl)amino]-N-[(2S)-3-methyl-1-oxobutan-2-yl]hexanamide (PubChem CID 174947831) has the molecular formula C13H23IN2O3 and a molecular weight of 382.24 g/mol. Its IUPAC name is 6-[(2-iodoacetyl)amino]-N-[(2S)-3-methyl-1-oxobutan-2-yl]hexanamide.
| Compound Name | 6-[(2-iodoacetyl)amino]-N-[(2S)-3-methyl-1-oxobutan-2-yl]hexanamide |
|---|---|
| PubChem CID | 174947831 |
| Molecular Formula | C13H23IN2O3 |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 6-[(2-iodoacetyl)amino]-N-[(2S)-3-methyl-1-oxobutan-2-yl]hexanamide |
| SMILES | CC(C)[C@@H](C=O)NC(=O)CCCCCNC(=O)CI |
| InChI | InChI=1S/C13H23IN2O3/c1-10(2)11(9-17)16-12(18)6-4-3-5-7-15-13(19)8-14/h9-11H,3-8H2,1-2H3,(H,15,19)(H,16,18)/t11-/m1/s1 |
| InChIKey | LAUJSAOBYFVKEL-LLVKDONJSA-N |
| XLogP | 1.44 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|