C8H17IN2O2 — CID 138614680
N-[2-[(1-hydroxy-2-methylpropyl)amino]ethyl]-2-iodoacetamide (PubChem CID 138614680) has the molecular formula C8H17IN2O2 and a molecular weight of 300.14 g/mol. Its IUPAC name is N-[2-[(1-hydroxy-2-methylpropyl)amino]ethyl]-2-iodoacetamide.
| Compound Name | N-[2-[(1-hydroxy-2-methylpropyl)amino]ethyl]-2-iodoacetamide |
|---|---|
| PubChem CID | 138614680 |
| Molecular Formula | C8H17IN2O2 |
| Molecular Weight | 300.14 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | N-[2-[(1-hydroxy-2-methylpropyl)amino]ethyl]-2-iodoacetamide |
| SMILES | CC(C)C(O)NCCNC(=O)CI |
| InChI | InChI=1S/C8H17IN2O2/c1-6(2)8(13)11-4-3-10-7(12)5-9/h6,8,11,13H,3-5H2,1-2H3,(H,10,12) |
| InChIKey | DJSARBLAIMNCLS-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.14 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|