C12H18ClNO — CID 121016044
1-[2-(4-chlorophenyl)ethylamino]-2-methylpropan-1-ol (PubChem CID 121016044) has the molecular formula C12H18ClNO and a molecular weight of 227.74 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethylamino]-2-methylpropan-1-ol.
| Compound Name | 1-[2-(4-chlorophenyl)ethylamino]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 121016044 |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethylamino]-2-methylpropan-1-ol |
| SMILES | CC(C)C(O)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H18ClNO/c1-9(2)12(15)14-8-7-10-3-5-11(13)6-4-10/h3-6,9,12,14-15H,7-8H2,1-2H3 |
| InChIKey | AYLNPVNAYHALEK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|