C27H33BrCl3NO2 — CID 67017125
1-bromo-2-(4-chlorophenyl)-N-[2-(4-chlorophenyl)ethyl]ethanamine;2-(4-chlorophenyl)ethanol;propan-2-ol (PubChem CID 67017125) has the molecular formula C27H33BrCl3NO2 and a molecular weight of 589.83 g/mol. Its IUPAC name is 1-bromo-2-(4-chlorophenyl)-N-[2-(4-chlorophenyl)ethyl]ethanamine;2-(4-chlorophenyl)ethanol;propan-2-ol.
| Compound Name | 1-bromo-2-(4-chlorophenyl)-N-[2-(4-chlorophenyl)ethyl]ethanamine;2-(4-chlorophenyl)ethanol;propan-2-ol |
|---|---|
| PubChem CID | 67017125 |
| Molecular Formula | C27H33BrCl3NO2 |
| Molecular Weight | 589.83 g/mol |
| Exact Mass | 587.08 |
| IUPAC Name | 1-bromo-2-(4-chlorophenyl)-N-[2-(4-chlorophenyl)ethyl]ethanamine;2-(4-chlorophenyl)ethanol;propan-2-ol |
| SMILES | CC(C)O.Clc1ccc(CCNC(Br)Cc2ccc(Cl)cc2)cc1.OCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H16BrCl2N.C8H9ClO.C3H8O/c17-16(11-13-3-7-15(19)8-4-13)20-10-9-12-1-5-14(18)6-2-12;9-8-3-1-7(2-4-8)5-6-10;1-3(2)4/h1-8,16,20H,9-11H2;1-4,10H,5-6H2;3-4H,1-2H3 |
| InChIKey | APNNKVQVVWAZMA-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.83 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|