C19H24ClNO3S — CID 139649181
1-(4-chlorophenyl)-N-[2-[4-(3-hydroxypropyl)phenyl]ethyl]ethanesulfonamide (PubChem CID 139649181) has the molecular formula C19H24ClNO3S and a molecular weight of 381.93 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[2-[4-(3-hydroxypropyl)phenyl]ethyl]ethanesulfonamide.
| Compound Name | 1-(4-chlorophenyl)-N-[2-[4-(3-hydroxypropyl)phenyl]ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 139649181 |
| Molecular Formula | C19H24ClNO3S |
| Molecular Weight | 381.93 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[2-[4-(3-hydroxypropyl)phenyl]ethyl]ethanesulfonamide |
| SMILES | CC(c1ccc(Cl)cc1)S(=O)(=O)NCCc1ccc(CCCO)cc1 |
| InChI | InChI=1S/C19H24ClNO3S/c1-15(18-8-10-19(20)11-9-18)25(23,24)21-13-12-17-6-4-16(5-7-17)3-2-14-22/h4-11,15,21-22H,2-3,12-14H2,1H3 |
| InChIKey | GCEXBLQQBWBROX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.93 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |