C17H30N2O2S — CID 10064973
N-[3-(dimethylamino)propyl]-1-[4-(2-methylpropyl)phenyl]ethanesulfonamide (PubChem CID 10064973) has the molecular formula C17H30N2O2S and a molecular weight of 326.51 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-1-[4-(2-methylpropyl)phenyl]ethanesulfonamide.
| Compound Name | N-[3-(dimethylamino)propyl]-1-[4-(2-methylpropyl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 10064973 |
| Molecular Formula | C17H30N2O2S |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-1-[4-(2-methylpropyl)phenyl]ethanesulfonamide |
| SMILES | CC(C)Cc1ccc(C(C)S(=O)(=O)NCCCN(C)C)cc1 |
| InChI | InChI=1S/C17H30N2O2S/c1-14(2)13-16-7-9-17(10-8-16)15(3)22(20,21)18-11-6-12-19(4)5/h7-10,14-15,18H,6,11-13H2,1-5H3 |
| InChIKey | QVOGHXJQPKWVLD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|