C19H22ClNO3S — CID 70373571
5-chloro-2-ethenyl-N-[2-[4-(3-hydroxypropyl)phenyl]ethyl]benzenesulfonamide (PubChem CID 70373571) has the molecular formula C19H22ClNO3S and a molecular weight of 379.91 g/mol. Its IUPAC name is 5-chloro-2-ethenyl-N-[2-[4-(3-hydroxypropyl)phenyl]ethyl]benzenesulfonamide.
| Compound Name | 5-chloro-2-ethenyl-N-[2-[4-(3-hydroxypropyl)phenyl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 70373571 |
| Molecular Formula | C19H22ClNO3S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 5-chloro-2-ethenyl-N-[2-[4-(3-hydroxypropyl)phenyl]ethyl]benzenesulfonamide |
| SMILES | C=Cc1ccc(Cl)cc1S(=O)(=O)NCCc1ccc(CCCO)cc1 |
| InChI | InChI=1S/C19H22ClNO3S/c1-2-17-9-10-18(20)14-19(17)25(23,24)21-12-11-16-7-5-15(6-8-16)4-3-13-22/h2,5-10,14,21-22H,1,3-4,11-13H2 |
| InChIKey | HBARZPCCXBAIGU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |