C8H11ClN2O3S — CID 43345872
2-amino-4-chloro-N-(2-hydroxyethyl)benzenesulfonamide (PubChem CID 43345872) has the molecular formula C8H11ClN2O3S and a molecular weight of 250.71 g/mol. Its IUPAC name is 2-amino-4-chloro-N-(2-hydroxyethyl)benzenesulfonamide.
| Compound Name | 2-amino-4-chloro-N-(2-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43345872 |
| Molecular Formula | C8H11ClN2O3S |
| Molecular Weight | 250.71 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 2-amino-4-chloro-N-(2-hydroxyethyl)benzenesulfonamide |
| SMILES | Nc1cc(Cl)ccc1S(=O)(=O)NCCO |
| InChI | InChI=1S/C8H11ClN2O3S/c9-6-1-2-8(7(10)5-6)15(13,14)11-3-4-12/h1-2,5,11-12H,3-4,10H2 |
| InChIKey | SQSIPJOKWHQSAA-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.71 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|