C10H16ClN3O4S2 — CID 106333180
2-amino-4-chloro-N-[3-(methanesulfonamido)propyl]benzenesulfonamide (PubChem CID 106333180) has the molecular formula C10H16ClN3O4S2 and a molecular weight of 341.84 g/mol. Its IUPAC name is 2-amino-4-chloro-N-[3-(methanesulfonamido)propyl]benzenesulfonamide.
| Compound Name | 2-amino-4-chloro-N-[3-(methanesulfonamido)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106333180 |
| Molecular Formula | C10H16ClN3O4S2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 2-amino-4-chloro-N-[3-(methanesulfonamido)propyl]benzenesulfonamide |
| SMILES | CS(=O)(=O)NCCCNS(=O)(=O)c1ccc(Cl)cc1N |
| InChI | InChI=1S/C10H16ClN3O4S2/c1-19(15,16)13-5-2-6-14-20(17,18)10-4-3-8(11)7-9(10)12/h3-4,7,13-14H,2,5-6,12H2,1H3 |
| InChIKey | DIIKEXXFBDPEKK-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|