C10H15ClFN3O4S2 — CID 106333254
5-amino-3-chloro-2-fluoro-N-[3-(methanesulfonamido)propyl]benzenesulfonamide (PubChem CID 106333254) has the molecular formula C10H15ClFN3O4S2 and a molecular weight of 359.83 g/mol. Its IUPAC name is 5-amino-3-chloro-2-fluoro-N-[3-(methanesulfonamido)propyl]benzenesulfonamide.
| Compound Name | 5-amino-3-chloro-2-fluoro-N-[3-(methanesulfonamido)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106333254 |
| Molecular Formula | C10H15ClFN3O4S2 |
| Molecular Weight | 359.83 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 5-amino-3-chloro-2-fluoro-N-[3-(methanesulfonamido)propyl]benzenesulfonamide |
| SMILES | CS(=O)(=O)NCCCNS(=O)(=O)c1cc(N)cc(Cl)c1F |
| InChI | InChI=1S/C10H15ClFN3O4S2/c1-20(16,17)14-3-2-4-15-21(18,19)9-6-7(13)5-8(11)10(9)12/h5-6,14-15H,2-4,13H2,1H3 |
| InChIKey | AAJZWWTUGMXESW-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.83 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|