C10H11ClN2O3S — CID 43501464
5-chloro-2-cyano-N-(3-hydroxypropyl)benzenesulfonamide (PubChem CID 43501464) has the molecular formula C10H11ClN2O3S and a molecular weight of 274.73 g/mol. Its IUPAC name is 5-chloro-2-cyano-N-(3-hydroxypropyl)benzenesulfonamide.
| Compound Name | 5-chloro-2-cyano-N-(3-hydroxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43501464 |
| Molecular Formula | C10H11ClN2O3S |
| Molecular Weight | 274.73 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 5-chloro-2-cyano-N-(3-hydroxypropyl)benzenesulfonamide |
| SMILES | N#Cc1ccc(Cl)cc1S(=O)(=O)NCCCO |
| InChI | InChI=1S/C10H11ClN2O3S/c11-9-3-2-8(7-12)10(6-9)17(15,16)13-4-1-5-14/h2-3,6,13-14H,1,4-5H2 |
| InChIKey | ALOWSHWMBVMCMA-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.73 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|