C14H17ClN2O3S — CID 106126720
5-chloro-2-cyano-N-[(4-hydroxycyclohexyl)methyl]benzenesulfonamide (PubChem CID 106126720) has the molecular formula C14H17ClN2O3S and a molecular weight of 328.82 g/mol. Its IUPAC name is 5-chloro-2-cyano-N-[(4-hydroxycyclohexyl)methyl]benzenesulfonamide.
| Compound Name | 5-chloro-2-cyano-N-[(4-hydroxycyclohexyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106126720 |
| Molecular Formula | C14H17ClN2O3S |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 5-chloro-2-cyano-N-[(4-hydroxycyclohexyl)methyl]benzenesulfonamide |
| SMILES | N#Cc1ccc(Cl)cc1S(=O)(=O)NCC1CCC(O)CC1 |
| InChI | InChI=1S/C14H17ClN2O3S/c15-12-4-3-11(8-16)14(7-12)21(19,20)17-9-10-1-5-13(18)6-2-10/h3-4,7,10,13,17-18H,1-2,5-6,9H2 |
| InChIKey | OTUHCLLOCQVDDI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |